CAS 1365545-48-7
:(4bS,6aS,7S,9aS,9bS)-N-[2,5-Bis(trifluoromethyl)phenyl]-2,4b,5,6,6a,7,8,9,9a,9b,10,11-dodecahydro-6a-methyl-2-oxo-1H-indeno[5,4-f]quinoline-7-carboxamide
Description:
The chemical substance with the name "(4bS,6aS,7S,9aS,9bS)-N-[2,5-Bis(trifluoromethyl)phenyl]-2,4b,5,6,6a,7,8,9,9a,9b,10,11-dodecahydro-6a-methyl-2-oxo-1H-indeno[5,4-f]quinoline-7-carboxamide" and CAS number "1365545-48-7" is a complex organic compound characterized by its intricate polycyclic structure, which includes a quinoline moiety fused with an indeno framework. The presence of multiple stereocenters indicates that the compound exhibits chirality, which can influence its biological activity and interactions. The incorporation of trifluoromethyl groups suggests enhanced lipophilicity and potential bioactivity, as these groups can significantly affect the electronic properties of the molecule. Additionally, the carboxamide functional group may contribute to hydrogen bonding capabilities, impacting solubility and reactivity. Overall, this compound's unique structural features and functional groups position it as a candidate for various applications, potentially in medicinal chemistry or materials science, although specific biological or chemical properties would require further investigation.
Formula:C26H26F6N2O2
InChI:InChI=1S/C26H26F6N2O2/c1-24-11-10-14-15(3-8-20-16(14)4-9-22(35)33-20)17(24)6-7-19(24)23(36)34-21-12-13(25(27,28)29)2-5-18(21)26(30,31)32/h2,4-5,9,12,14-15,17,19H,3,6-8,10-11H2,1H3,(H,33,35)(H,34,36)/t14-,15+,17-,19+,24-/m0/s1
InChI key:InChIKey=CTNHFYMGIWYKRI-HUFDCIJMSA-N
SMILES:C[C@@]12[C@]([C@]3([C@@](C4=C(CC3)NC(=O)C=C4)(CC1)[H])[H])(CC[C@@H]2C(NC5=C(C(F)(F)F)C=CC(C(F)(F)F)=C5)=O)[H]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
