CAS 136561-40-5
:2-(1-Adamantyl)-N-Hydroxyacetamide
Description:
2-(1-Adamantyl)-N-Hydroxyacetamide is a chemical compound characterized by its unique structure, which includes an adamantyl group, a hydroxyacetamide moiety, and a nitrogen atom bonded to a hydroxyl group. This compound typically exhibits properties associated with both amides and hydroxyl groups, such as potential hydrogen bonding capabilities, which can influence its solubility and reactivity. The presence of the adamantyl group, a polycyclic hydrocarbon, contributes to its hydrophobic characteristics, potentially affecting its interaction with biological membranes and other organic compounds. This compound may be of interest in medicinal chemistry due to its structural features, which could impart specific biological activities or enhance the pharmacokinetic properties of related drug candidates. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including NMR and mass spectrometry for structural confirmation. Overall, 2-(1-Adamantyl)-N-Hydroxyacetamide represents a compound with potential applications in pharmaceutical research, particularly in the development of novel therapeutic agents.
Formula:C12H19NO2
InChI:InChI=1/C12H19NO2/c14-11(13-15)7-12-4-8-1-9(5-12)3-10(2-8)6-12/h8-10,15H,1-7H2,(H,13,14)
SMILES:C1C2CC3CC1CC(C2)(C3)CC(=NO)O
Synonyms:- 2-(Adamantan-1-yl)-N-hydroxyacetamide
- tricyclo[3.3.1.1~3,7~]decane-1-acetamide, N-hydroxy-
- N-hydroxy-2-tricyclo[3.3.1.1~3,7~]dec-1-ylacetamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-(Adamantan-1-yl)-N-hydroxyacetamide
CAS:<p>2-(Adamantan-1-yl)-N-hydroxyacetamide is a cell permeable, linker that binds to the bacterial membrane and inhibits the protein gene transcription. It has been shown to be effective against hepatitis B virus (HBV). This active form binds to HBV particles and inactivates them by preventing viral RNA synthesis. 2-(Adamantan-1-yl)-N-hydroxyacetamide also prevents the release of virus particles from infected cells. This active form is also effective against HIV, influenza virus, and herpes simplex type 1 viruses. 2-(Adamantan-1-yl)-N-hydroxyacetamide has been shown to inhibit the activity of human polymerase chain reaction in vitro.</p>Formula:C12H19NO2Purity:Min. 95%Molecular weight:209.28 g/mol

