CAS 136561-53-0
:(2R,3S)-3-Phenylisoserine
Description:
(2R,3S)-3-Phenylisoserine is an amino acid derivative characterized by its chiral centers at the second and third carbon atoms, which contribute to its specific stereochemistry. This compound features a phenyl group attached to the beta carbon, influencing its hydrophobic properties and potential interactions in biological systems. It is a non-proteinogenic amino acid, meaning it is not incorporated into proteins during translation but may play roles in various biochemical pathways or serve as a building block for synthetic compounds. The presence of the phenyl group can enhance its ability to interact with aromatic residues in proteins, potentially affecting binding affinities and biological activity. Additionally, (2R,3S)-3-Phenylisoserine may exhibit unique solubility characteristics due to its structural features, which can impact its behavior in different solvents. Its specific stereochemistry is crucial for its biological function and interactions, making it a subject of interest in medicinal chemistry and drug design. Overall, this compound's unique structure and properties make it relevant in various fields, including pharmaceuticals and biochemistry.
Formula:C9H13NO2
InChI:InChI=1/C9H13NO2/c10-9(8(12)6-11)7-4-2-1-3-5-7/h1-5,8-9,11-12H,6,10H2/t8-,9-/m0/s1
SMILES:c1ccc(cc1)[C@@H]([C@H](CO)O)N
Synonyms:- (2R,3S)-3-amino-3-phenylpropane-1,2-diol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-(2R,3S)-Phenylisoserine
CAS:<p>3-(2R,3S)-Phenylisoserine is a chiral enantiomer that can be used in organic synthesis. It is a reactive compound and has the ability to form amide bonds with other compounds. 3-(2R,3S)-Phenylisoserine is also able to react with nitro groups and form an oxime. It is not soluble in water but it is soluble in organic solvents like acetone or methanol. 3-(2R,3S)-Phenylisoserine can be synthesized by the enzymatic methods of benzyloxymethyl hydrazine and hydrochloric acid.</p>Formula:C9H11NO3Purity:Min. 95%Color and Shape:PowderMolecular weight:181.19 g/mol
