CAS 13657-16-4

Benzyloxazolidine; 97%

Description:

Benzyloxazolidine, with the CAS number 13657-16-4, is a chemical compound characterized by its oxazolidine ring structure, which is fused with a benzyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific formulation. It is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The presence of the oxazolidine moiety contributes to its reactivity, allowing it to participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Benzyloxazolidine is also noted for its stability under standard conditions, although it may be sensitive to strong acids or bases. As a substance with a purity of 97%, it is generally considered suitable for research and industrial applications, although proper handling and safety precautions are essential due to its chemical nature. Always consult safety data sheets and relevant literature for specific handling guidelines and potential hazards associated with this compound.

Formula: C₁₀H₁₃NO

InChI: InChI=1/C10H13NO/c1-2-4-10(5-3-1)8-11-6-7-12-9-11/h1-5H,6-9H2

SMILES: c1ccc(cc1)CN1CCOC1

Synonyms:

• 3-Benzyloxazolidine
• 3-Benzyl-1,3-Oxazolidine

3-Benzyloxazolidine

CAS: 13657-16-4

Formula: C₁₀H₁₃NO

Purity: >98.0%(GC)(T)

Color and Shape: Colorless to Light yellow clear liquid

Molecular weight: 163.22

Ref: 3B-B1339

Oxazolidine, 3-(phenylmethyl)-

CAS: 13657-16-4

Formula: C₁₀H₁₃NO

Purity: 98%

Color and Shape: Liquid

Molecular weight: 163.2163

Ref: IN-DA00123G

3-Benzyloxazolidine

CAS: 13657-16-4

3-Benzyloxazolidine

Purity: 98%

Molecular weight: 163.22g/mol

Ref: 54-OR936664

3-Benzyloxazolidine

CAS: 13657-16-4

Purity: 98%(GC-MS);RG

Molecular weight: 163.2200012

Ref: 10-F721314