CAS 13657-68-6: (+)-Curdione
Description:(+)-Curdione is a naturally occurring sesquiterpene compound primarily derived from the essential oil of the turmeric plant, Curcuma longa. It is characterized by its unique bicyclic structure, which contributes to its distinctive aroma and potential biological activities. The compound is known for its anti-inflammatory, antioxidant, and antimicrobial properties, making it of interest in both medicinal and cosmetic applications. (+)-Curdione exhibits a chiral center, resulting in its specific optical activity, which is denoted by the prefix "(+)" indicating its dextrorotatory nature. In terms of physical properties, it is typically a colorless to pale yellow liquid with a characteristic scent. Its solubility varies, being more soluble in organic solvents than in water. The compound's stability and reactivity can be influenced by environmental factors such as temperature and light. Research continues to explore its potential therapeutic benefits, particularly in the context of chronic diseases and as a natural preservative in food and cosmetic formulations.
Formula:C15H24O2
InChI:InChI=1/C15H24O2/c1-10(2)13-9-14(16)12(4)7-5-6-11(3)8-15(13)17/h6,10,12-13H,5,7-9H2,1-4H3/b11-6+/t12-,13-/m0/s1
InChI key:InChIKey=KDPFMRXIVDLQKX-NHFJXKHHSA-N
SMILES:O=C1CC(=CCCC(C(=O)CC1C(C)C)C)C
- Synonyms:
- (3S,6E,10S)-6,10-Dimethyl-3-(1-methylethyl)-6-cyclodecene-1,4-dione
- (3S,6E,10S)-6,10-Dimethyl-3-propan-2-ylcyclodec-6-ene-1,4-dione
- (3S,6E,10S)-6,10-dimethyl-3-(1-methylethyl)cyclodec-6-ene-1,4-dione
- 6-Cyclodecene-1,4-dione, 6,10-dimethyl-3-(1-methylethyl)-, (3S,6E,10S)-
- 6-Cyclodecene-1,4-dione, 6,10-dimethyl-3-(1-methylethyl)-, [3S-(3R*,6E,10R*)]-
- Curdione
- Germacr-1(10)-ene-5,8-dione
