CAS 136590-83-5
:3,5-dichloro-4-formyl pyridine
Description:
3,5-Dichloro-4-formyl pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of two chlorine atoms at the 3 and 5 positions of the ring contributes to its reactivity and influences its physical properties, such as solubility and boiling point. The formyl group (-CHO) at the 4 position introduces a carbonyl functionality, making it an aldehyde, which is significant for its potential in various chemical reactions, including condensation and nucleophilic addition. This compound is typically a pale yellow to brown solid and is soluble in organic solvents. It is used in the synthesis of various pharmaceuticals and agrochemicals, owing to its ability to participate in further chemical transformations. Additionally, the presence of halogens can enhance its biological activity, making it a subject of interest in medicinal chemistry. Safety precautions should be observed when handling this compound, as it may pose health risks due to its reactive nature and potential toxicity.
Formula:C6H3Cl2NO
InChI:InChI=1/C6H3Cl2NO/c7-5-1-9-2-6(8)4(5)3-10/h1-3H
SMILES:c1c(c(C=O)c(cn1)Cl)Cl
Synonyms:- Timtec-Bb Sbb003785
- 3,5-Dichloroisonicotinaldehyde
- 3,5-Dichloro-4-pyridinecarboxaldehyde
- 3,5-Dichloropyridine-4-carboxyaldehyde
- 3,5-Dichloropyridine-4-carboxaldehyde
- 4-pyridinecarboxaldehyde, 3,5-Dichloro-
- 3,5-Dichloropyridine-4-Carbaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Pyridinecarboxaldehyde, 3,5-dichloro-
CAS:Formula:C6H3Cl2NOPurity:97%Color and Shape:SolidMolecular weight:176.00013,5-Dichloroisonicotinaldehyde
CAS:3,5-DichloroisonicotinaldehydeFormula:C6H3Cl2NOPurity:≥95%Color and Shape: yellow crystalline powderMolecular weight:176.00g/mol3,5-Dichloro-4-pyridinecarboxaldehyde
CAS:Formula:C6H3Cl2NOPurity:>98.0%(GC)Color and Shape:White to Brown powder to crystalMolecular weight:176.003,5-Dichloroisonicotinaldehyde
CAS:Formula:C6H3Cl2NOPurity:95%Color and Shape:SolidMolecular weight:1763,5-Dichloro-4-pyridinecarboxaldehyde
CAS:3,5-Dichloro-4-pyridinecarboxaldehyde is a synthetic heterocycle that has been studied for its pharmacokinetic properties. The compound has the ability to bind to the active site of metalloporphyrin and inhibit the enzyme's activity. This inhibition leads to an increase in the levels of homologous aldehydes, which are oxidized by hydrogen peroxide to produce electrosprays. 3,5-Dichloro-4-pyridinecarboxaldehyde also has a number of oxidation products that have been found in experiments using purines as substrates.
Formula:C6H3Cl2NOPurity:Min. 95%Molecular weight:176 g/mol




