
CAS 1365920-38-2
:1,6,7,8-Tetrahydro-N-[2-(1,6,7,8-tetrahydro-2H-indeno[5,4-b]furan-8-yl)ethyl]-2H-indeno[5,4-b]furan-8-ethanamine
Description:
1,6,7,8-Tetrahydro-N-[2-(1,6,7,8-tetrahydro-2H-indeno[5,4-b]furan-8-yl)ethyl]-2H-indeno[5,4-b]furan-8-ethanamine, with CAS number 1365920-38-2, is a complex organic compound characterized by its multi-ring structure, which includes indeno and furan moieties. This compound features a tetrahydro configuration, indicating the presence of saturated rings, which contributes to its stability and potential biological activity. The presence of an amine functional group suggests that it may exhibit basic properties and could participate in hydrogen bonding, influencing its solubility and reactivity. The intricate arrangement of its rings and substituents may also impart unique pharmacological properties, making it of interest in medicinal chemistry. Its synthesis and characterization would typically involve advanced organic synthesis techniques, and its potential applications could range from pharmaceuticals to materials science, depending on its specific interactions and properties. Further studies would be necessary to fully elucidate its behavior in various chemical environments and its potential uses.
Formula:C26H31NO2
InChI:InChI=1S/C26H31NO2/c1-3-19(25-17(1)5-7-23-21(25)11-15-28-23)9-13-27-14-10-20-4-2-18-6-8-24-22(26(18)20)12-16-29-24/h5-8,19-20,27H,1-4,9-16H2
InChI key:InChIKey=CRGFKLZOBJUOCB-UHFFFAOYSA-N
SMILES:C(CNCCC1C=2C3=C(C=CC2CC1)OCC3)C4C=5C6=C(C=CC5CC4)OCC6
Synonyms:- 2H-Indeno[5,4-b]furan-8-ethanamine, 1,6,7,8-tetrahydro-N-[2-(1,6,7,8-tetrahydro-2H-indeno[5,4-b]furan-8-yl)ethyl]-
- 1,6,7,8-Tetrahydro-N-[2-(1,6,7,8-tetrahydro-2H-indeno[5,4-b]furan-8-yl)ethyl]-2H-indeno[5,4-b]furan-8-ethanamine
- Indoline impurity 4
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
