CymitQuimica logo

CAS 1365937-09-2

:

N-(3S)-3-Pyrrolidinyl-2-pyridinamine

Description:
N-(3S)-3-Pyrrolidinyl-2-pyridinamine, identified by its CAS number 1365937-09-2, is a chemical compound characterized by its unique structural features, which include a pyrrolidine ring and a pyridine moiety. This compound typically exhibits properties associated with amines, such as basicity due to the presence of nitrogen atoms. The stereochemistry indicated by the (3S) designation suggests that it has a specific three-dimensional arrangement, which can influence its biological activity and interactions with other molecules. N-(3S)-3-Pyrrolidinyl-2-pyridinamine may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar structures often exhibit significant biological activity, including potential roles as enzyme inhibitors or receptor modulators. Its solubility, stability, and reactivity would depend on the functional groups present and the overall molecular structure. As with many organic compounds, its properties can be influenced by environmental factors such as pH and temperature.
Formula:C9H13N3
InChI:InChI=1S/C9H13N3/c1-2-5-11-9(3-1)12-8-4-6-10-7-8/h1-3,5,8,10H,4,6-7H2,(H,11,12)/t8-/m0/s1
InChI key:InChIKey=HEMVTRSSBJCRGX-QMMMGPOBSA-N
SMILES:N(C1=CC=CC=N1)[C@H]2CCNC2
Synonyms:
  • 2-Pyridinamine, N-(3S)-3-pyrrolidinyl-
  • N-(3S)-3-Pyrrolidinyl-2-pyridinamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.