CAS 1365961-89-2

Methyl 6-acetyl-2-[(2-chloroacetyl)amino]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxylate

Description:

Methyl 6-acetyl-2-[(2-chloroacetyl)amino]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxylate is a complex organic compound characterized by its unique thieno-pyridine structure, which incorporates both a methyl ester and an acetyl group. This compound features a thieno[2,3-c]pyridine core, which contributes to its potential biological activity, particularly in medicinal chemistry. The presence of the chloroacetyl group suggests reactivity that could be exploited in further chemical modifications or in the synthesis of derivatives. The compound's molecular structure indicates it may exhibit properties such as solubility in organic solvents, potential for hydrogen bonding due to the presence of amine and ester functionalities, and possible interactions with biological targets. Its specific applications may include roles in drug development or as a research chemical, particularly in studies related to pharmacology or organic synthesis. As with many such compounds, safety and handling precautions are essential due to the presence of chlorine and other reactive functional groups.

Formula: C₁₃H₁₅ClN₂O₄S

InChI: InChI=1S/C13H15ClN2O4S/c1-7(17)16-4-3-8-9(6-16)21-12(15-10(18)5-14)11(8)13(19)20-2/h3-6H2,1-2H3,(H,15,18)

InChI key: InChIKey=LQWXYSVYVDFJBA-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C2=C(SC1NC(CCl)=O)CN(C(C)=O)CC2

Synonyms:

• Methyl 6-acetyl-2-[(2-chloroacetyl)amino]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxylate
• Thieno[2,3-c]pyridine-3-carboxylic acid, 6-acetyl-2-[(2-chloroacetyl)amino]-4,5,6,7-tetrahydro-, methyl ester