CymitQuimica logo

CAS 1365969-60-3

:

1-Piperidinecarboxylic acid, 4-[(2,2,2-trifluoroethyl)amino]-, 1,1-dimethylethyl ester, hydrochloride (1:1)

Description:
1-Piperidinecarboxylic acid, 4-[(2,2,2-trifluoroethyl)amino]-, 1,1-dimethylethyl ester, hydrochloride (1:1), with CAS number 1365969-60-3, is a chemical compound characterized by its piperidine core, which is a six-membered nitrogen-containing heterocycle. The presence of a carboxylic acid functional group indicates potential acidity, while the ester moiety suggests it can undergo hydrolysis. The trifluoroethyl group contributes to the compound's lipophilicity and may influence its biological activity, particularly in medicinal chemistry applications. The hydrochloride salt form enhances solubility in aqueous solutions, making it suitable for pharmaceutical formulations. This compound may exhibit specific pharmacological properties due to its structural features, including potential interactions with biological targets. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be of interest in research related to drug development or as a biochemical probe. Safety data and handling precautions should be observed, as with any chemical substance, particularly those with potential biological activity.
Formula:C12H21F3N2O2·ClH
InChI:InChI=1S/C12H21F3N2O2.ClH/c1-11(2,3)19-10(18)17-6-4-9(5-7-17)16-8-12(13,14)15;/h9,16H,4-8H2,1-3H3;1H
InChI key:InChIKey=PSJIRTNVYUPFRM-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CCC(NCC(F)(F)F)CC1.Cl
Synonyms:
  • 1-Piperidinecarboxylic acid, 4-[(2,2,2-trifluoroethyl)amino]-, 1,1-dimethylethyl ester, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.