CAS 1365969-81-8
:1,1-Dimethylethyl 3-(2-pyrimidinylamino)-1-azetidinecarboxylate
Description:
1,1-Dimethylethyl 3-(2-pyrimidinylamino)-1-azetidinecarboxylate, identified by its CAS number 1365969-81-8, is a chemical compound characterized by its unique structural features. It contains an azetidine ring, which is a four-membered saturated heterocyclic structure, and is substituted with a pyrimidinylamino group, contributing to its potential biological activity. The presence of the dimethyl group indicates steric hindrance, which may influence the compound's reactivity and interaction with biological targets. This compound is likely to exhibit properties typical of both azetidine derivatives and pyrimidine-containing compounds, such as potential pharmacological effects. Its carboxylate functional group suggests it may participate in various chemical reactions, including esterification and amidation. The specific characteristics, such as solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other functional groups. Overall, this compound may be of interest in medicinal chemistry and drug development due to its structural complexity and potential therapeutic applications.
Formula:C12H18N4O2
InChI:InChI=1S/C12H18N4O2/c1-12(2,3)18-11(17)16-7-9(8-16)15-10-13-5-4-6-14-10/h4-6,9H,7-8H2,1-3H3,(H,13,14,15)
InChI key:InChIKey=VFHMEWBMMDQOAT-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CC(NC=2N=CC=CN2)C1
Synonyms:- 1,1-Dimethylethyl 3-(2-pyrimidinylamino)-1-azetidinecarboxylate
- 1-Azetidinecarboxylic acid, 3-(2-pyrimidinylamino)-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
