CAS 1365969-84-1
:1,1-Dimethylethyl N-[[1-(4-quinazolinyl)-4-piperidinyl]methyl]carbamate
Description:
1,1-Dimethylethyl N-[[1-(4-quinazolinyl)-4-piperidinyl]methyl]carbamate, identified by its CAS number 1365969-84-1, is a chemical compound that belongs to the class of carbamates. This substance features a complex molecular structure characterized by the presence of a dimethyl group, a quinazoline moiety, and a piperidine ring, which contribute to its potential biological activity. Typically, compounds of this nature may exhibit pharmacological properties, making them of interest in medicinal chemistry and drug development. The presence of the quinazoline and piperidine groups suggests potential interactions with biological targets, possibly influencing neurotransmitter systems or other cellular pathways. Additionally, the carbamate functional group may impart specific reactivity and stability characteristics. As with many organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Safety and handling precautions are essential when working with such substances, as they may pose health risks or environmental hazards.
Formula:C19H26N4O2
InChI:InChI=1S/C19H26N4O2/c1-19(2,3)25-18(24)20-12-14-8-10-23(11-9-14)17-15-6-4-5-7-16(15)21-13-22-17/h4-7,13-14H,8-12H2,1-3H3,(H,20,24)
InChI key:InChIKey=VDMWKYGUOALPOL-UHFFFAOYSA-N
SMILES:C(NC(OC(C)(C)C)=O)C1CCN(C=2C3=C(N=CN2)C=CC=C3)CC1
Synonyms:- Carbamic acid, N-[[1-(4-quinazolinyl)-4-piperidinyl]methyl]-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl N-[[1-(4-quinazolinyl)-4-piperidinyl]methyl]carbamate
- tert-Butyl N-{[1-(quinazolin-4-yl)piperidin-4-yl]methyl}carbamate
- Tert-butyl ((1-(quinazolin-4-yl)piperidin-4-yl)methyl)carbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Tert-Butyl N-[1-(quinazolin-4-yl)piperidin-4-yl]methylcarbamate
CAS:Molecular weight:342.4429931640625
