CymitQuimica logo

CAS 1365988-35-7

:

2,5-Bis(trifluoromethyl)pyrazine

Description:
2,5-Bis(trifluoromethyl)pyrazine is a heterocyclic organic compound characterized by the presence of a pyrazine ring substituted with two trifluoromethyl groups at the 2 and 5 positions. This compound is notable for its strong electron-withdrawing trifluoromethyl groups, which significantly influence its chemical reactivity and physical properties. It typically appears as a colorless to pale yellow solid and is soluble in organic solvents. The presence of the trifluoromethyl groups enhances its lipophilicity and can impart unique properties, making it of interest in various applications, including pharmaceuticals and agrochemicals. Additionally, the compound may exhibit interesting electronic properties due to the electron-withdrawing nature of the trifluoromethyl groups, potentially affecting its behavior in chemical reactions and interactions with biological systems. Safety data should be consulted for handling, as the trifluoromethyl groups can contribute to toxicity and environmental concerns. Overall, 2,5-Bis(trifluoromethyl)pyrazine is a compound of interest in both synthetic and applied chemistry contexts.
Formula:C6H2F6N2
InChI:InChI=1S/C6H2F6N2/c7-5(8,9)3-1-13-4(2-14-3)6(10,11)12/h1-2H
InChI key:InChIKey=DUCHHTWSOPWERT-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=NC(C(F)(F)F)=CN1
Synonyms:
  • Pyrazine, 2,5-bis(trifluoromethyl)-
  • 2,5-Bis(trifluoromethyl)pyrazine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.