CAS 1365988-36-8: 3-Cyclobutyl-5,6,7,8-tetrahydro-1H-1,2,4-triazolo[4,3-a][1,3]diazepine

Description: 3-Cyclobutyl-5,6,7,8-tetrahydro-1H-1,2,4-triazolo[4,3-a][1,3]diazepine is a heterocyclic compound characterized by its complex bicyclic structure, which incorporates both a triazole and a diazepine moiety. This compound features a cyclobutyl group, contributing to its unique three-dimensional conformation and potential steric effects. The presence of the tetrahydro structure indicates that it contains multiple saturated carbon atoms, which can influence its reactivity and stability. The triazole ring is known for its ability to participate in various chemical reactions, including coordination with metal ions and formation of hydrogen bonds, making it a versatile scaffold in medicinal chemistry. Additionally, compounds of this type may exhibit biological activity, potentially serving as pharmacological agents. The specific properties, such as solubility, melting point, and reactivity, would depend on the molecular interactions and substituents present in the compound. Overall, 3-Cyclobutyl-5,6,7,8-tetrahydro-1H-1,2,4-triazolo[4,3-a][1,3]diazepine represents an interesting subject for further research in drug development and synthetic chemistry.

Formula: C₁₀H₁₆N₄

InChI: InChI=1S/C10H16N4/c1-2-7-14-9(8-4-3-5-8)12-13-10(14)11-6-1/h8H,1-7H2,(H,11,13)

InChI key: InChIKey=SOAXQCCDTMZNKB-UHFFFAOYSA-N

SMILES: N=1NC2=NCCCCN2C1C3CCC3

Synonyms:

• 1H-1,2,4-Triazolo[4,3-a][1,3]diazepine, 3-cyclobutyl-5,6,7,8-tetrahydro-
• 3-Cyclobutyl-5,6,7,8-tetrahydro-1H-1,2,4-triazolo[4,3-a][1,3]diazepine

3-Cyclobutyl-5H,6H,7H,8H,9H-[1,2,4]-triazolo[4,3-a][1,3]diazepine

CAS: 1365988-36-8

• Molecular weight: 192.26600646972656

3-Cyclobutyl-5H,6H,7H,8H,9H-[1,2,4]triazolo[4,3-a][1,3]diazepine

CAS: 1365988-36-8

Versatile small molecule scaffold

• Formula: C₁₀H₁₆N₄
• Purity: Min. 95%
• Molecular weight: 192.26 g/mol