CAS 136604-58-5

5-Thiazoleethanamine, 2-amino-4-methyl-, hydrochloride (1:2)

Description:

5-Thiazoleethanamine, 2-amino-4-methyl-, hydrochloride (1:2) is a chemical compound characterized by its thiazole ring structure, which contributes to its biological activity. This compound features an amino group and a methyl group attached to the thiazole, enhancing its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications in pharmaceuticals and research. The presence of the thiazole moiety often indicates potential antimicrobial or antifungal properties, as thiazole derivatives are known for their biological significance. The compound's molecular structure allows for interactions with biological targets, which may lead to therapeutic effects. Additionally, its synthesis and characterization involve standard organic chemistry techniques, and it is important to handle it with care due to potential toxicity. Overall, 5-Thiazoleethanamine, 2-amino-4-methyl-, hydrochloride is a compound of interest in medicinal chemistry and related fields.

Formula: C₆H₁₁N₃S·2ClH

InChI: InChI=1S/C6H11N3S.2ClH/c1-4-5(2-3-7)10-6(8)9-4;;/h2-3,7H2,1H3,(H2,8,9);2*1H

InChI key: InChIKey=NQUYKSNCKIXTQF-UHFFFAOYSA-N

SMILES: C(CN)C1=C(C)N=C(N)S1.Cl

Synonyms:

• 5-Thiazoleethanamine, 2-amino-4-methyl-, hydrochloride (1:2)
• 5-Thiazoleethanamine, 2-amino-4-methyl-, dihydrochloride

Amthamine 2HCl

CAS: 136604-58-5

Amthamine 2HCl

Purity: ≥95%

Molecular weight: 230.159g/mol

Ref: 54-BUP04024

Amthamine 2HCl

CAS: 136604-58-5

5-(2-aminoethyl)-4-methyl-1,3-thiazol-2-amine dihydrochloride is a selective mGluR5 antagonist effective in various neurological disorders.

Formula: C₆H₁₃Cl₂N₃S

Purity: 98.61%

Color and Shape: Solid

Molecular weight: 230.159

Ref: TM-T50112

5-(2-Aminoethyl)-4-methyl-1,3-thiazol-2-amine dihydrochloride

CAS: 136604-58-5

Versatile small molecule scaffold

Formula: C₆H₁₃Cl₂N₃S

Purity: Min. 95%

Molecular weight: 230.16 g/mol

Ref: 3D-LFA60458