CAS 136609-59-1

2-(3-Chloropropyl)-1-methyl-1H-imidazole

Description:

2-(3-Chloropropyl)-1-methyl-1H-imidazole is an organic compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a chloropropyl group at the 2-position and a methyl group at the 1-position of the imidazole ring. The presence of the chlorine atom introduces a polar functional group, which can influence the compound's reactivity and solubility in various solvents. The imidazole moiety is known for its biological significance, often found in various pharmaceuticals and biologically active compounds. This substance may exhibit properties such as antimicrobial activity or serve as a building block in the synthesis of more complex molecules. Its molecular structure suggests potential applications in medicinal chemistry, agrochemicals, or as a ligand in coordination chemistry. Safety and handling precautions should be observed due to the presence of chlorine, which can pose health risks. As with any chemical, thorough characterization and understanding of its properties are essential for its application in research or industry.

Formula: C₇H₁₁ClN₂

InChI: InChI=1S/C7H11ClN2/c1-10-6-5-9-7(10)3-2-4-8/h5-6H,2-4H2,1H3

InChI key: InChIKey=CEARPOBYHDFQFM-UHFFFAOYSA-N

SMILES: C(CCCl)C=1N(C)C=CN1

Synonyms:

• 2-(3-Chloropropyl)-1-methyl-1H-imidazole
• 1H-Imidazole, 2-(3-chloropropyl)-1-methyl-