CAS 136620-24-1

2-[(4-methylbenzyl)sulfanyl]aniline

Description:

2-[(4-Methylbenzyl)sulfanyl]aniline, with the CAS number 136620-24-1, is an organic compound characterized by the presence of both an aniline group and a sulfanyl (thioether) functional group. This compound features a benzene ring substituted with a methyl group and a sulfanyl group attached to the aniline nitrogen. The presence of the sulfanyl group imparts unique chemical properties, such as increased nucleophilicity and potential reactivity in various chemical reactions, including substitution and oxidation processes. The compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic aromatic components, while its aniline structure may contribute to some degree of polarity. Additionally, the presence of the methyl group can influence the steric and electronic properties, affecting its reactivity and interactions with other molecules. Overall, 2-[(4-methylbenzyl)sulfanyl]aniline is of interest in organic synthesis and may have applications in pharmaceuticals or materials science, depending on its specific reactivity and functionalization potential.

Formula: C₁₄H₁₅NS

InChI: InChI=1/C14H15NS/c1-11-6-8-12(9-7-11)10-16-14-5-3-2-4-13(14)15/h2-9H,10,15H2,1H3

SMILES: Cc1ccc(cc1)CSc1ccccc1N