CymitQuimica logo

CAS 136624-42-5

:

4-AMINO-1-BENZYLPIPERIDINE-4-CARBONITRILE

Description:
4-Amino-1-benzylpiperidine-4-carbonitrile is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of an amino group (-NH2) at the 4-position and a benzyl group attached to the 1-position of the piperidine ring contributes to its unique properties. The carbonitrile functional group (-C≡N) at the 4-position enhances its reactivity and potential applications in organic synthesis. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its molecular structure suggests potential biological activity, making it of interest in medicinal chemistry for the development of pharmaceuticals. The compound's CAS number, 136624-42-5, allows for easy identification in chemical databases and literature. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C13H17N3
InChI:InChI=1S/C13H17N3/c14-11-13(15)6-8-16(9-7-13)10-12-4-2-1-3-5-12/h1-5H,6-10,15H2
InChI key:GKFZBGLUEBXSBF-UHFFFAOYSA-N
SMILES:C1CN(CCC1(C#N)N)CC2=CC=CC=C2
Found 4 products.