CAS 13664-49-8

N-hydroxy-4-methoxy-N-phenylbenzamide

Description:

N-hydroxy-4-methoxy-N-phenylbenzamide, with the CAS number 13664-49-8, is an organic compound characterized by its structural features, which include a benzamide backbone substituted with a methoxy group and a hydroxylamine functional group. This compound typically appears as a solid at room temperature and is soluble in organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly as a precursor for various pharmaceutical compounds or as an intermediate in organic synthesis. The presence of the hydroxylamine group may impart specific reactivity, making it useful in reactions such as oxidation or coupling reactions. Additionally, the methoxy group can influence the compound's electronic properties and steric hindrance, affecting its biological activity and interaction with other molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.

Formula: C₁₄H₁₃NO₃

InChI: InChI=1/C14H13NO3/c1-18-13-9-7-11(8-10-13)14(16)15(17)12-5-3-2-4-6-12/h2-10,17H,1H3

SMILES: COc1ccc(cc1)C(=O)N(c1ccccc1)O

Synonyms:

• benzamide, N-hydroxy-4-methoxy-N-phenyl-
• N-Hydroxy-4-methoxy-N-phenylbenzamide

N-Hydroxy-4-methoxy-N-phenylbenzamide

CAS: 13664-49-8

Formula: C₁₄H₁₃NO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 243.2579

Ref: IN-DA001264