CAS 13669-28-8
:1-Methyl-4-methylene-piperidine
Description:
1-Methyl-4-methylene-piperidine, with the CAS number 13669-28-8, is a nitrogen-containing heterocyclic compound characterized by a piperidine ring that has a methyl group and a methylene group attached. This compound typically exhibits a colorless to pale yellow liquid form and has a distinctive amine-like odor. It is soluble in organic solvents, which is common for many piperidine derivatives, but its solubility in water is limited due to the hydrophobic nature of the piperidine ring. The presence of the methylene group introduces a degree of unsaturation, which can influence its reactivity, making it a potential candidate for various chemical reactions, including alkylation and nucleophilic substitution. Additionally, 1-Methyl-4-methylene-piperidine may exhibit biological activity, which could be of interest in medicinal chemistry. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C7H13N
InChI:InChI=1/C7H13N/c1-7-3-5-8(2)6-4-7/h1,3-6H2,2H3
SMILES:C=C1CCN(C)CC1
Synonyms:- Piperidine, 1-methyl,4-methylene-
- 1-Methyl-4-Methylidenepiperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
