CAS 13669-32-4
:1,2-dimethylpiperidin-4-one
Description:
1,2-Dimethylpiperidin-4-one, with the CAS number 13669-32-4, is a chemical compound belonging to the class of piperidines, which are six-membered heterocyclic compounds containing nitrogen. This particular compound features two methyl groups attached to the first and second carbon atoms of the piperidine ring, along with a ketone functional group at the fourth position. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the ketone group contributes to its reactivity, making it useful in various organic synthesis applications, including the production of pharmaceuticals and agrochemicals. The compound exhibits moderate polarity due to the nitrogen atom and the carbonyl group, influencing its solubility in organic solvents. Additionally, it may participate in nucleophilic reactions and can serve as a building block in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C7H13NO
InChI:InChI=1/C7H13NO/c1-6-5-7(9)3-4-8(6)2/h6H,3-5H2,1-2H3
SMILES:CC1CC(=O)CCN1C
Synonyms:- 4-Piperidinone, 1,2-Dimethyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1,2-Dimethylpiperidin-4-one
CAS:1,2-Dimethylpiperidin-4-one is a chiral compound that can be used to make optically active compounds. It is an important intermediate in the synthesis of piperidones. The 1,2-dimethylpiperidin-4-one has two diastereomers, which are called cis and trans. The cis configuration has a methyl group in the same plane as the amine group, whereas the trans configuration has the methyl group in a different plane. The cis configuration is more stable than the trans one and this is because it is less sterically hindered by the bulky groups on either side of it. This means that if you want to make an optical pure compound, it will be easier to do so using cis rather than trans 1,2-dimethylpiperidin-4-one.Formula:C7H13NOPurity:Min. 95%Molecular weight:127.18 g/mol

