CymitQuimica logo

CAS 13669-58-4

:

6-Methoxy-3-quinolinecarbonitrile

Description:
6-Methoxy-3-quinolinecarbonitrile is an organic compound characterized by its quinoline structure, which features a nitrogen atom in the aromatic ring. This compound contains a methoxy group (-OCH3) at the 6-position and a cyano group (-CN) at the 3-position of the quinoline ring. The presence of these functional groups contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The methoxy group can enhance solubility and influence the compound's biological activity, while the cyano group can participate in nucleophilic reactions. 6-Methoxy-3-quinolinecarbonitrile is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. As with many quinoline derivatives, this compound may possess interesting pharmacological properties, making it a subject of interest in medicinal chemistry research.
Formula:C11H8N2O
InChI:InChI=1S/C11H8N2O/c1-14-10-2-3-11-9(5-10)4-8(6-12)7-13-11/h2-5,7H,1H3
InChI key:InChIKey=IWDUVIPVMFJQJF-UHFFFAOYSA-N
SMILES:C(#N)C1=CC2=C(C=CC(OC)=C2)N=C1
Synonyms:
  • 6-Methoxy-3-cyanoquinoline
  • 3-Quinolinecarbonitrile, 6-methoxy-
  • 6-Methoxy-3-quinolinecarbonitrile
  • 6-methoxyquinoline-3-carbonitrile
Found 3 products.