CymitQuimica logo

CAS 13669-67-5

:

6-Amino-3-quinolinecarbonitrile

Description:
6-Amino-3-quinolinecarbonitrile is an organic compound characterized by its quinoline structure, which consists of a fused bicyclic system containing a benzene ring and a pyridine ring. The presence of an amino group (-NH2) at the 6-position and a cyano group (-C≡N) at the 3-position contributes to its reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the amino group, while the cyano group can enhance its ability to participate in nucleophilic reactions. Its unique structure allows it to interact with biological targets, making it of interest in drug development and synthesis of bioactive molecules. Additionally, 6-amino-3-quinolinecarbonitrile may exhibit various biological activities, including antimicrobial and antitumor properties, although specific activities can vary based on structural modifications and the presence of other functional groups. As with many organic compounds, handling should be done with care, considering potential toxicity and environmental impact.
Formula:C10H7N3
InChI:InChI=1S/C10H7N3/c11-5-7-3-8-4-9(12)1-2-10(8)13-6-7/h1-4,6H,12H2
InChI key:InChIKey=RUBZFZDEKLOULN-UHFFFAOYSA-N
SMILES:C(#N)C1=CC2=C(N=C1)C=CC(N)=C2
Synonyms:
  • 3-Quinolinecarbonitrile, 6-amino-
  • 6-Amino-3-quinolinecarbonitrile
Found 2 products.