CAS 136735-95-0
:(+)-1,2-BIS[(2S,5S)-2,5-DIMETHYLPHOSPHOLANO]BENZENE
Description:
(+)-1,2-BIS[(2S,5S)-2,5-DIMETHYLPHOSPHOLANO]BENZENE, with CAS number 136735-95-0, is a chiral organophosphorus compound characterized by its unique phospholane moieties attached to a benzene ring. This compound features two dimethylphospholane groups, which contribute to its stereochemistry and potential biological activity. The presence of the dimethylphospholane units imparts specific steric and electronic properties, making it of interest in various fields, including medicinal chemistry and materials science. The chirality of the molecule, indicated by the (2S,5S) configuration, suggests that it may exhibit enantioselective behavior in chemical reactions or biological interactions. Additionally, the compound's structure may influence its solubility, reactivity, and interaction with other molecules, which are critical factors in its application. Overall, this compound represents a fascinating area of study due to its complex structure and potential utility in synthetic and applied chemistry.
Formula:C18H28P2
InChI:InChI=1/C18H28P2/c1-13-9-10-14(2)19(13)17-7-5-6-8-18(17)20-15(3)11-12-16(20)4/h5-8,13-16H,9-12H2,1-4H3/t13-,14-,15-,16-/m0/s1
SMILES:C[C@H]1CC[C@H](C)P1c1ccccc1P1[C@@H](C)CC[C@@H]1C
Synonyms:- (S,S)-Me-Duphos
- (S,S)-Methyl-Duphos
- (2S,2'S,5S,5'S)-2,2',5,5'-Tetramethyl-1,1'-(1,2-Phenylene)Diphospholane
- (2S,2'S,5S,5'S)-2,2',5,5'-Tetramethyl-1,1'-(O-Phenylene)Diphospholane
- (+)-1,2-Bis((2S,5S)-2,5-dimethylphospholano)benzene,98+%(S,S)-Me-DUPHOS
- (2S,5S,2'S,5'S)-1,1'-benzene-1,2-diylbis(2,5-dimethylphospholane)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1,2-Bis[(2S,5S)-2,5-dimethyl-1-phospholanyl]benzene, 97+%
CAS:It is a DuPhos and BPE ligands which are highly efficient privileged ligands. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or
Formula:C18H28P2Purity:97+%Color and Shape:Colorless to white, Powder or crystals or crystalline powderMolecular weight:306.37(+)-1,2-Bis[(2S,5S)-2,5-Dimethylphospholano]Benzene
CAS:Formula:C18H28P2Purity:97%Color and Shape:SolidMolecular weight:306.36241,2-Bis((2S,5S)-2,5-Dimethylphospholan-1-Yl)Benzene
CAS:1,2-Bis((2S,5S)-2,5-Dimethylphospholan-1-Yl)BenzenePurity:98%Molecular weight:306.36g/mol(+)-1,2-Bis((2S,5S)-2,5-dimethylphospholano)benzene, min. 98% (S,S)-Me-DUPHOS
CAS:(+)-1,2-Bis((2S,5S)-2,5-dimethylphospholano)benzene, 98+% (S,S)-Me-DUPHOS
Formula:C18H28P2Purity:min. 98%Color and Shape:white xtl.Molecular weight:306.37





