CAS 13676-48-7
:5-Amino-2-(3-aminophenyl)benzoxazole
Description:
5-Amino-2-(3-aminophenyl)benzoxazole is an organic compound characterized by its benzoxazole core, which is a bicyclic structure containing both benzene and oxazole rings. This compound features amino groups that enhance its reactivity and solubility in various solvents. It typically appears as a solid at room temperature and may exhibit a range of colors depending on its purity and specific formulation. The presence of amino groups suggests potential applications in pharmaceuticals, particularly in the development of biologically active compounds, as these functional groups can participate in hydrogen bonding and other interactions. Additionally, the compound may exhibit fluorescence properties, making it useful in analytical chemistry and biological imaging. Its molecular structure allows for various synthetic modifications, which can lead to derivatives with tailored properties for specific applications. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.
Formula:C13H11N3O
InChI:InChI=1/C13H11N3O/c14-9-3-1-2-8(6-9)13-16-11-7-10(15)4-5-12(11)17-13/h1-7H,14-15H2
SMILES:c1cc(cc(c1)N)c1nc2cc(ccc2o1)N
Synonyms:- 5-Amino-2-(m-aminophenyl)benzoxazole
- 2-(3-Aminophenyl)-1,3-Benzoxazol-5-Amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-Benzoxazolamine, 2-(3-aminophenyl)-
CAS:Formula:C13H11N3OColor and Shape:SolidMolecular weight:225.2459
