CymitQuimica logo

CAS 136777-27-0

:

1,5-Divinylhexamethyltrisiloxane

Description:
1,5-Divinylhexamethyltrisiloxane is a siloxane compound characterized by its unique structure, which includes a trisiloxane backbone and two vinyl groups. This compound typically exhibits properties common to siloxanes, such as low surface tension, thermal stability, and resistance to moisture. The presence of vinyl groups allows for potential reactivity, making it useful in various applications, including as a precursor in silicone polymer synthesis and in formulations requiring cross-linking. Its molecular structure contributes to its fluidity and ability to form films, which can enhance its utility in coatings and sealants. Additionally, the compound is generally considered to have low toxicity, making it suitable for use in consumer products. However, specific handling and safety guidelines should be followed, as with all chemical substances. Overall, 1,5-Divinylhexamethyltrisiloxane is valued for its versatility in industrial applications, particularly in the fields of materials science and polymer chemistry.
Formula:C10H24O2Si3
InChI:InChI=1/C10H24O2Si3/c1-9-13(3,4)11-15(7,8)12-14(5,6)10-2/h9-10H,1-2H2,3-8H3
SMILES:C=C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C=C
Synonyms:
  • 1,5-Diethenyl-1,1,3,3,5,5-Hexamethyltrisiloxane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.