CAS 1367936-67-1

1,1-Dimethylethyl [2,2′-bipiperidine]-1-carboxylate

Description:

1,1-Dimethylethyl [2,2′-bipiperidine]-1-carboxylate is a chemical compound characterized by its unique structure, which includes a bipiperidine moiety and a carboxylate functional group. This compound typically exhibits properties associated with both amines and esters, such as potential basicity and reactivity towards nucleophiles. The presence of the dimethyl group contributes to steric hindrance, which can influence its reactivity and interactions with other molecules. The bipiperidine structure may impart specific pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound's solubility and stability can vary depending on the solvent and environmental conditions. It is important to handle this substance with care, as it may have specific safety and toxicity profiles that require consideration in laboratory settings. Overall, 1,1-Dimethylethyl [2,2′-bipiperidine]-1-carboxylate represents a complex organic molecule with potential applications in various fields, including pharmaceuticals and materials science.

Formula: C₁₅H₂₈N₂O₂

InChI: InChI=1S/C15H28N2O2/c1-15(2,3)19-14(18)17-11-7-5-9-13(17)12-8-4-6-10-16-12/h12-13,16H,4-11H2,1-3H3

InChI key: InChIKey=XOZZUEAIFAOYDA-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1C(CCCC1)C2CCCCN2

Synonyms:

• [2,2′-Bipiperidine]-1-carboxylic acid, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl [2,2′-bipiperidine]-1-carboxylate

tert-Butyl [2,2'-bipiperidine]-1-carboxylate

CAS: 1367936-67-1

Versatile small molecule scaffold

Formula: C₁₅H₂₈N₂O₂

Purity: Min. 95%

Molecular weight: 268.4 g/mol

Ref: 3D-SEC93667