CAS 1367992-90-2

1-Methyl-1H-benzimidazole-7-carboxaldehyde

Description:

1-Methyl-1H-benzimidazole-7-carboxaldehyde is an organic compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound features a methyl group at the nitrogen position of the imidazole ring and an aldehyde functional group at the 7-position of the benzimidazole. It is typically a white to off-white solid, soluble in polar organic solvents, and may exhibit moderate stability under standard conditions. The presence of the aldehyde group suggests it can participate in various chemical reactions, including condensation and oxidation. This compound may have applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis due to its unique structural features. Additionally, its potential biological activity could be of interest in medicinal chemistry, although specific biological properties would require further investigation. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.

Formula: C₉H₈N₂O

InChI: InChI=1S/C9H8N2O/c1-11-6-10-8-4-2-3-7(5-12)9(8)11/h2-6H,1H3

InChI key: InChIKey=QUZYUJFBSDECDP-UHFFFAOYSA-N

SMILES: C(=O)C1=C2C(N=CN2C)=CC=C1

Synonyms:

• 1H-Benzimidazole-7-carboxaldehyde, 1-methyl-
• 1-Methyl-1H-benzimidazole-7-carboxaldehyde

1-Methyl-1H-1,3-benzodiazole-7-carbaldehyde

CAS: 1367992-90-2

Versatile small molecule scaffold

Formula: C₉H₈N₂O

Purity: Min. 95%

Molecular weight: 160.17 g/mol

Ref: 3D-SEC99290