CAS 136803-89-9
:10'-desmethoxystreptonigrin
Description:
10'-Desmethoxystreptonigrin is a chemical compound that belongs to the class of streptonigrin derivatives, which are known for their antibiotic properties. This compound is characterized by its complex molecular structure, which includes a quinone moiety and a polyketide backbone. It exhibits significant biological activity, particularly as an antitumor agent, and has been studied for its potential use in cancer therapy. The compound's mechanism of action typically involves the inhibition of DNA synthesis and interference with cellular processes, making it a subject of interest in medicinal chemistry. Additionally, 10'-desmethoxystreptonigrin may possess unique solubility and stability characteristics, influencing its bioavailability and therapeutic efficacy. Its CAS number, 136803-89-9, is a unique identifier that facilitates the identification and study of this compound in scientific literature and databases. Overall, 10'-desmethoxystreptonigrin represents a significant area of research in the development of novel anticancer agents.
Formula:C24H20N4O7
InChI:InChI=1/C24H20N4O7/c1-9-14(10-5-4-6-13(34-2)20(10)29)15(25)19(28-17(9)24(32)33)12-8-7-11-18(27-12)22(31)16(26)23(35-3)21(11)30/h4-8,28H,25-26H2,1-3H3,(H,32,33)/b14-10+
Synonyms:- 10'-Demethoxystreptonigrin
- 2-Pyridinecarboxylic acid, 5-amino-6-(7-amino-5,8-dihydro-6-methoxy-5,8-dioxo-2-quinolinyl)-4-(2-hydroxy-3-methoxyphenyl)-3-methyl-
- (4E)-5-amino-6-(7-amino-6-methoxy-5,8-dioxo-5,8-dihydroquinolin-2-yl)-4-(5-methoxy-6-oxocyclohexa-2,4-dien-1-ylidene)-3-methyl-1,4-dihydropyridine-2-carboxylic acid
- 10'-Desmethoxystreptonigrin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
10'-Desmethoxystreptonigrin
CAS:'10'-Desmethoxystreptonigrin antibiotic derived from streptonigrin combats various bacteria and cancer cells, and inhibits p21ras farnesylation (IC50 = 21 nM).Formula:C24H20N4O7Color and Shape:SolidMolecular weight:476.44510’-Desmethoxystreptonigrin
CAS:Controlled ProductFormula:C24H20N4O7Color and Shape:NeatMolecular weight:476.438

