CAS 136816-75-6: Atevirdine

Description:Atevirdine is a synthetic compound classified as a non-nucleoside reverse transcriptase inhibitor (NNRTI), primarily developed for the treatment of HIV infection. It functions by selectively inhibiting the reverse transcriptase enzyme, which is crucial for the replication of the HIV virus. Atevirdine exhibits a unique chemical structure that allows it to bind to the enzyme, thereby preventing the conversion of viral RNA into DNA, a critical step in the viral life cycle. The compound is characterized by its moderate lipophilicity, which influences its absorption and distribution in the body. Atevirdine has been studied for its efficacy and safety profile, although it is not widely used in clinical practice compared to other antiretroviral agents. Its pharmacokinetics, including metabolism and excretion, are important for understanding its therapeutic potential and interactions with other medications. Overall, Atevirdine represents a significant area of research in the ongoing efforts to develop effective treatments for HIV/AIDS.

Formula:C₂₁H₂₅N₅O₂

InChI:InChI=1S/C21H25N5O2/c1-3-22-18-5-4-8-23-20(18)25-9-11-26(12-10-25)21(27)19-14-15-13-16(28-2)6-7-17(15)24-19/h4-8,13-14,22,24H,3,9-12H2,1-2H3

InChI key:InChIKey=UCPOMLWZWRTIAA-UHFFFAOYSA-N

SMILES:O=C(C1=CC=2C=C(OC)C=CC2N1)N3CCN(C4=NC=CC=C4NCC)CC3

Synonyms:
[4-[3-(Ethylamino)-2-pyridinyl]-1-piperazinyl](5-methoxy-1H-indol-2-yl)methanone
Methanone, [4-[3-(ethylamino)-2-pyridinyl]-1-piperazinyl](5-methoxy-1H-indol-2-yl)-
1-[3-(Ethylamino)-2-pyridyl]-4-[(5-methoxyindol-2-yl)carbonyl]piperazine
U 87201
Piperazine, 1-[3-(ethylamino)-2-pyridinyl]-4-[(5-methoxy-1H-indol-2-yl)carbonyl]-