CAS 136818-50-3

1H-PYRROLO[2,3-B]PYRIDINE-2-CARBOXYLIC ACID

Description:

1H-Pyrrolo[2,3-b]pyridine-2-carboxylic acid, with the CAS number 136818-50-3, is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. This compound typically exhibits a solid-state form and is known for its potential biological activity, making it of interest in medicinal chemistry. The carboxylic acid functional group enhances its solubility in polar solvents and can participate in various chemical reactions, such as esterification and amidation. Its structure allows for potential interactions with biological targets, which may lead to applications in drug development. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization. Overall, 1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid represents a valuable scaffold in organic synthesis and pharmaceutical research due to its structural complexity and functional versatility.

Formula: C₈H₆N₂O₂

InChI: InChI=1/C8H6N2O2/c11-8(12)6-4-5-2-1-3-9-7(5)10-6/h1-4H,(H,9,10)(H,11,12)

SMILES: c1cc2cc(C(=O)O)[nH]c2nc1

Synonyms:

• 1H-Pyrrolo[2,3-b]pyridine-2-carboxylicacid(9CI)

1H-Pyrrolo[2,3-b]pyridine-2-carboxylic acid

CAS: 136818-50-3

Formula: C₈H₆N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 162.1454

Ref: IN-DA003EEU

7-Azaindole-2-carboxylic acid

CAS: 136818-50-3

7-Azaindole-2-carboxylic acid

Purity: 97%

Molecular weight: 162.15g/mol

Ref: 54-OR46104

1H-Pyrrolo[2,3-b]pyridine-2-carboxylic acid

CAS: 136818-50-3

Formula: C₈H₆N₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 162.148

Ref: 10-F076992