CAS 13682-32-1
:5-methyl-2-phenyl-1H-imidazole-4-methanol
Description:
5-Methyl-2-phenyl-1H-imidazole-4-methanol, with the CAS number 13682-32-1, is a chemical compound that belongs to the class of imidazole derivatives. This substance features a five-membered aromatic ring containing two nitrogen atoms, which contributes to its unique chemical properties. The presence of a methyl group and a phenyl group enhances its hydrophobic characteristics, while the hydroxymethyl group at the 4-position introduces polar functional properties, making it potentially soluble in polar solvents. The compound may exhibit biological activity, as many imidazole derivatives are known for their pharmacological properties, including antifungal and antimicrobial activities. Its structural features suggest that it could participate in various chemical reactions, such as nucleophilic substitutions or coordination with metal ions. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents on the imidazole ring. Overall, 5-methyl-2-phenyl-1H-imidazole-4-methanol is a versatile compound with potential applications in medicinal chemistry and material science.
Formula:C11H12N2O
InChI:InChI=1/C11H12N2O/c1-8-10(7-14)13-11(12-8)9-5-3-2-4-6-9/h2-6,14H,7H2,1H3,(H,12,13)
InChI key:InChIKey=RUEBPOOTFCZRBC-UHFFFAOYSA-N
SMILES:C(O)C=1NC(=NC1C)C2=CC=CC=C2
Synonyms:- (4-Methyl-2-phenyl-1H-imidazol-5-yl)methanol
- (5-methyl-2-phenyl-1H-imidazol-4-yl)methanol
- 1H-Imidazole-4-methanol, 5-methyl-2-phenyl-
- 1H-Imidazole-5-methanol, 4-methyl-2-phenyl-
- 2-Phenyl-4-methyl-5-hydroxymethylimidazole
- 2P4Mhz
- 2P4Mhz-Pw
- 4-Methyl-2-phenyl-1H-imidazole-5-methanol
- 5-(Hydroxymethyl)-4-methyl-2-phenylimidazole
- Curezol 2P4MHZ
- Curezol 2P4MHZ-PW
- Imidazole-4-methanol, 5-methyl-2-phenyl-
- 5-Methyl-2-phenyl-1H-imidazole-4-methanol
- 2-Phenyl-4-hydroxyMethyl-5-MethyliMidazole
- Einecs 237-187-5
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1H-Imidazole-5-methanol, 4-methyl-2-phenyl-
CAS:Formula:C11H12N2OPurity:97%Color and Shape:SolidMolecular weight:188.2258(4-Methyl-2-phenyl-1H-imidazol-5-yl)methanol
CAS:Formula:C11H12N2OPurity:>97.0%(T)(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:188.235-Methyl-2-phenyl-1H-imidazole-4-methanol
CAS:5-Methyl-2-phenyl-1H-imidazole-4-methanolPurity:97%Molecular weight:188.23g/mol4-Hydroxymethyl-5-methyl-2-phenylimidazole
CAS:4-Hydroxymethyl-5-methyl-2-phenylimidazole is an impurity of phenoxy. It has a high resistance to acids and bases, and can be used in devices that require high purity. 4-Hydroxymethyl-5-methyl-2-phenylimidazole has a particle diameter of about 1 micron. This impurity is metastable, or stable only under certain conditions such as temperature and pressure. The high viscosity of this compound makes it useful for devices that require a high degree of stability at elevated temperatures. Immediate decomposition occurs when exposed to air due to the presence of naphthalene, phosphine, and silicon.Formula:C11H12N2OPurity:Min. 95%Molecular weight:188.23 g/mol



