CAS 13687-09-7
:BIS(AZIRIDINYL)METHYLAMINO PHOSPHINE SULFIDE
Description:
BIS(AZIRIDINYL)METHYLAMINO PHOSPHINE SULFIDE, with the CAS number 13687-09-7, is a chemical compound characterized by its unique structure that includes aziridine rings and a phosphine sulfide functional group. The presence of aziridine, a three-membered nitrogen-containing heterocycle, suggests that this compound may exhibit interesting reactivity, particularly in nucleophilic substitution reactions due to the strain in the aziridine rings. The phosphine sulfide moiety indicates potential applications in coordination chemistry and catalysis, as phosphines are known for their ability to stabilize various metal complexes. Additionally, the sulfide group may impart specific properties such as increased reactivity or altered solubility in organic solvents. This compound may also be of interest in the field of medicinal chemistry, given the biological activity often associated with aziridine derivatives. However, detailed studies on its toxicity, stability, and specific applications would be necessary to fully understand its potential uses and safety profile.
Formula:C5H12N3PS
InChI:InChI=1/C5H12N3PS/c1-6-9(10,7-2-3-7)8-4-5-8/h2-5H2,1H3,(H,6,10)
SMILES:CNP(=S)(N1CC1)N1CC1
Synonyms:- Bisazir
- P,P-bis(aziridin-1-yl)-N-methylphosphinothioic amide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Phosphinothioic amide, P,P-bis(1-aziridinyl)-N-methyl-
CAS:Formula:C5H12N3PSMolecular weight:177.2076Bisazir
CAS:Bisazir effects male sterility in Anopheles albimanus mosquitoes.Formula:C5H12N3PSColor and Shape:SolidMolecular weight:177.21


