CAS 136880-97-2
:P 569
Description:
P 569, with the CAS number 136880-97-2, is a chemical compound that belongs to a class of substances known for their specific applications in various fields, including pharmaceuticals and materials science. While detailed information about its characteristics may not be widely available, compounds with similar identifiers often exhibit unique properties such as specific solubility profiles, reactivity, and stability under various conditions. Typically, such substances may be characterized by their molecular structure, which influences their physical and chemical properties, including melting and boiling points, density, and potential interactions with other chemicals. Additionally, safety data sheets (SDS) for such compounds would provide essential information regarding handling, toxicity, and environmental impact. For precise applications and characteristics, consulting specialized databases or scientific literature is recommended, as they can provide insights into the compound's behavior in different environments and its potential uses in research or industry.
Formula:C17H22I3N3O9
InChI:InChI=1/C17H22I3N3O9/c18-11-9(15(30)21-1-2-24)12(19)14(13(20)10(11)16(31)22-6-27)23(3-7(28)4-25)17(32)8(29)5-26/h7-8,24-29H,1-6H2,(H,21,30)(H,22,31)
Synonyms:- 1,3-Benzenedicarboxamide, 5-((2,3-dihydroxy-1-oxopropyl)(2,3-dihydroxypropyl)amino)-N-(2-hydroxyethyl)-N'-(hydroxymethyl)-2,4,6-triiodo-
- 5-[(2,3-dihydroxypropanoyl)(2,3-dihydroxypropyl)amino]-N-(2-hydroxyethyl)-N'-(hydroxymethyl)-2,4,6-triiodobenzene-1,3-dicarboxamide
- P-569
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
P 569
CAS:P 569 is an MRI contrast medium.Formula:C17H22I3N3O9Color and Shape:SolidMolecular weight:793.08
