CAS 136888-21-6

2-CHLORO-5-FLUORO-3-NITROPYRIDINE

Description:

2-Chloro-5-fluoro-3-nitropyridine is a heterocyclic aromatic compound characterized by the presence of a pyridine ring substituted with three distinct functional groups: a chlorine atom, a fluorine atom, and a nitro group. The chlorine atom is located at the 2-position, the fluorine at the 5-position, and the nitro group at the 3-position of the pyridine ring. This compound is typically a yellow to orange solid and is known for its potential applications in pharmaceuticals and agrochemicals due to its unique electronic properties and reactivity. The presence of both electron-withdrawing (nitro and chloro) and electron-donating (fluoro) groups influences its chemical behavior, making it a valuable intermediate in organic synthesis. Additionally, the compound's structure allows for various reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, which are essential in the development of more complex molecules. Safety data should be consulted, as halogenated compounds can pose health and environmental risks.

Formula: C₉H₁₈ClN₂OP

InChI: InChI=1/C9H18ClN2OP/c1-8(2)12(9(3)4)14(10)13-7-5-6-11/h8-9H,5,7H2,1-4H3

SMILES: CC(C)N(C(C)C)P(Cl)OCCC#N

Synonyms:

• 2-Chloro-3-Nitro-5-Fluoropyridine
• 2-Cyanoethyl Bis(1-Methylethyl)Amidochlorophosphite
• 2-Chloro-5-Flouro-3-Nitropyridine

2-Chloro-5-fluoro-3-nitropyridine

CAS: 136888-21-6

Formula: C₅H₂ClFN₂O₂

Purity: >98.0%(GC)

Color and Shape: White to Yellow to Green powder to crystal

Molecular weight: 176.53

Ref: 3B-C3115

Pyridine, 2-chloro-5-fluoro-3-nitro-

CAS: 136888-21-6

Formula: C₅H₂ClFN₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 176.5330

Ref: IN-DA0012IR

2-Chloro-5-fluoro-3-nitropyridine

CAS: 136888-21-6

2-Chloro-5-fluoro-3-nitropyridine

Purity: 98%

Color and Shape: Pale Yellow Crystals

Molecular weight: 176.53g/mol

Ref: 54-PC50086

2-Chloro-5-fluoro-3-nitropyridine

CAS: 136888-21-6

Formula: C₅H₂ClFN₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 176.53

Ref: 10-F077383