CAS 1369149-71-2

5-Thiazolecarboxylic acid, 2-(1-aminoethyl)-4-methyl-, hydrochloride (1:1)

Description:

5-Thiazolecarboxylic acid, 2-(1-aminoethyl)-4-methyl-, hydrochloride (1:1) is a chemical compound characterized by its thiazole ring structure, which contributes to its biological activity and potential applications in pharmaceuticals. The presence of a carboxylic acid functional group indicates that it can participate in acid-base reactions, while the aminoethyl side chain suggests potential for interactions with biological targets, such as enzymes or receptors. The hydrochloride form indicates that the compound is a salt, which often enhances its solubility in water, making it more suitable for biological studies or medicinal applications. This compound may exhibit properties such as antimicrobial or anti-inflammatory activity, typical of thiazole derivatives. Its molecular structure allows for various functional group interactions, which can be crucial for its efficacy in biological systems. As with many compounds, the specific characteristics, including stability, reactivity, and biological activity, would depend on the conditions under which it is studied or utilized.

Formula: C₇H₁₀N₂O₂S·ClH

InChI: InChI=1S/C7H10N2O2S.ClH/c1-3(8)6-9-4(2)5(12-6)7(10)11;/h3H,8H2,1-2H3,(H,10,11);1H

InChI key: InChIKey=VVVMIDSJEZUXGC-UHFFFAOYSA-N

SMILES: C(C)(N)C=1SC(C(O)=O)=C(C)N1.Cl

Synonyms:

• 2-(1-Aminoethyl)-4-methyl-1,3-thiazole-5-carboxylic acid hydrochloride
• 5-Thiazolecarboxylic acid, 2-(1-aminoethyl)-4-methyl-, hydrochloride (1:1)

2-(1-Aminoethyl)-4-methyl-1,3-thiazole-5-carboxylic acid hydrochloride

CAS: 1369149-71-2

Versatile small molecule scaffold

Formula: C₇H₁₁ClN₂O₂S

Purity: Min. 95%

Molecular weight: 222.7 g/mol

Ref: 3D-UEC14971