CymitQuimica logo

CAS 136918-88-2

:

Ethanone, 1-(1,2,3-thiadiazol-5-yl)-

Description:
Ethanone, 1-(1,2,3-thiadiazol-5-yl)-, also known by its CAS number 136918-88-2, is a chemical compound characterized by the presence of a thiadiazole ring, which contributes to its unique properties. This compound features a carbonyl group (C=O) typical of ketones, specifically ethanone, and is substituted with a 1,2,3-thiadiazole moiety at the 1-position. The thiadiazole ring is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms, which can impart biological activity and influence the compound's reactivity. Generally, compounds containing thiadiazole derivatives are known for their potential applications in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. The presence of the thiadiazole group may enhance the compound's solubility and stability, making it suitable for various chemical reactions. Additionally, the compound's properties, such as melting point, boiling point, and solubility, would depend on its specific molecular interactions and the surrounding environment.
Formula:C4H4N2OS
InChI:InChI=1/C4H4N2OS/c1-3(7)4-2-5-6-8-4/h2H,1H3
SMILES:CC(=O)c1cnns1
Synonyms:
  • 1-(1,2,3-Thiadiazol-5-yl)ethanone
  • 1-(Thiadiazol-5-Yl)Ethanone
  • N-Boc-amino-4-methylthiazole-5-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.