CAS 136924-88-4

8-amino-2-cyano-3,3-dipropyl-6,7,8,9-tetrahydro-3H-benzo[e]indolium

Description:

8-amino-2-cyano-3,3-dipropyl-6,7,8,9-tetrahydro-3H-benzo[e]indolium, with the CAS number 136924-88-4, is a chemical compound characterized by its complex structure, which includes a benzo[e]indole framework. This compound features an amino group and a cyano group, contributing to its reactivity and potential biological activity. The presence of dipropyl substituents enhances its lipophilicity, which may influence its solubility and interaction with biological membranes. The tetrahydro configuration indicates that the compound contains saturated rings, which can affect its stability and conformational flexibility. Such compounds are often studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to their unique structural properties. Additionally, the presence of both amino and cyano functionalities suggests potential for further chemical modifications, making it a versatile candidate for various synthetic pathways. Overall, this compound's characteristics position it as an interesting subject for research in both organic chemistry and drug development.

Formula: C₁₉H₂₆N₃

InChI: InChI=1/C19H26N3/c1-3-9-22(10-4-2)16(13-20)12-18-17-11-15(21)7-5-14(17)6-8-19(18)22/h6,8,12,15H,3-5,7,9-11,21H2,1-2H3/q+1

SMILES: CCCN1(CCC)C(=Cc2c3CC(CCc3ccc12)N)C#N

U92016A

CAS: 136924-88-4

U92016A is a highly potent and selective agonist of 5-HT1A receptor.

Formula: C₁₉H₂₅N₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 295.42

Ref: TM-T29035