CAS 137019-37-5
:fluvirucin A1
Description:
Fluvirucin A1 is a chemical compound classified as a natural product, specifically a type of antibiotic. It is derived from the fermentation of certain strains of bacteria, particularly those belonging to the genus Streptomyces. This compound exhibits notable antimicrobial properties, making it of interest in pharmaceutical research and development. Fluvirucin A1 is characterized by its complex molecular structure, which includes multiple functional groups that contribute to its biological activity. The compound has been studied for its potential applications in treating various bacterial infections, particularly those resistant to conventional antibiotics. Its mechanism of action typically involves inhibiting bacterial protein synthesis, thereby preventing the growth and proliferation of pathogenic microorganisms. Additionally, research into fluvirucin A1 may reveal insights into its efficacy against specific strains of bacteria, as well as its safety profile and potential side effects. Overall, fluvirucin A1 represents a significant area of interest in the ongoing search for new antimicrobial agents.
Formula:C23H44N2O5
InChI:InChI=1/C23H44N2O5/c1-5-17-9-6-8-14(2)11-12-18(15(3)22(28)25-13-7-10-17)30-23-21(27)19(24)20(26)16(4)29-23/h14-21,23,26-27H,5-13,24H2,1-4H3,(H,25,28)/t14-,15-,16+,17+,18+,19-,20-,21-,23+/m1/s1
Synonyms:- Fluvirucins A1
- (3R,4S,7R,11S)-4-[(3-Amino-3,6-dideoxy-α-L-talopyranosyl)oxy]-3,7-dimethyl-11-ethyl-1-azacyclotetradecan-2-one
- 3-((3-Amino-3,6-dideoxy-alpha-L-talopyranosyl)oxy)-2,6-dimethyl-10-ethyl-13-tridecanelactam
- Fluvirucin A1
- Azacyclotetradecan-2-one, 4-[(3-amino-3,6-dideoxy-α-L-talopyranosyl)oxy]-11-ethyl-3,7-dimethyl-, (3R,4S,7R,11S)- (9CI)
- fluvirucin A1
- (3R,4S,7R,11S)-11-ethyl-3,7-dimethyl-2-oxoazacyclotetradecan-4-yl 3-amino-3,6-dideoxy-alpha-L-talopyranoside
- Azacyclotetradecan-2-one, 4-((3-amino-3,6-dideoxy-alpha-L-talopyranosyl)oxy)-11-ethyl-3,7-dimethyl-, (3R-(3R*,4S*,7R*,11S*))-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Fluvirucin A1
CAS:<p>Fluvirucin A1 is a novel antibiotic effective against the Influenza A virus.</p>Formula:C23H44N2O5Color and Shape:SolidMolecular weight:428.61
