CAS 137025-10-6
:4-(1H-pyrrol-1-ylmethyl)benzoic acid
Description:
4-(1H-pyrrol-1-ylmethyl)benzoic acid, identified by its CAS number 137025-10-6, is an organic compound featuring both a benzoic acid moiety and a pyrrole ring. This compound typically exhibits characteristics common to aromatic carboxylic acids, including a relatively high melting point and solubility in polar solvents due to the presence of the carboxylic acid functional group. The pyrrole ring contributes to its potential biological activity, as pyrrole derivatives are often associated with various pharmacological properties. The compound may engage in hydrogen bonding due to the carboxylic acid group, enhancing its solubility in water and other polar solvents. Additionally, the presence of the pyrrole nitrogen can influence its reactivity and interaction with other chemical species. Overall, 4-(1H-pyrrol-1-ylmethyl)benzoic acid is of interest in medicinal chemistry and materials science, where its unique structural features may be exploited for the development of new therapeutic agents or functional materials.
Formula:C12H11NO2
InChI:InChI=1/C12H11NO2/c14-12(15)11-5-3-10(4-6-11)9-13-7-1-2-8-13/h1-8H,9H2,(H,14,15)
SMILES:c1ccn(c1)Cc1ccc(cc1)C(=O)O
Synonyms:- benzoic acid, 4-(1H-pyrrol-1-ylmethyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4-Pyrrol-1-ylmethyl-benzoic acid
CAS:<p>4-Pyrrol-1-ylmethyl-benzoic acid is a silicon-containing compound that can be used as an electropolymerization initiator. It has been shown to be an efficient activator for the polymerization of carbodiimides in the presence of solvents, such as nitro groups and nitro compounds. 4-Pyrrol-1-ylmethyl-benzoic acid is a monomer that can be used in the preparation of biosensors with silicon nitride. This chemical is able to generate pores with diameters ranging from 1 to 10 nm. The permeation of this compound through membranes is also possible.</p>Formula:C12H11NO2Purity:Min. 95%Molecular weight:201.22 g/mol

