CAS 1370411-48-5

2,6-Pyrazinediamine, hydrochloride (1:1)

Description:

2,6-Pyrazinediamine, hydrochloride (1:1) is a chemical compound characterized by its pyrazine ring structure, which features two amino groups located at the 2 and 6 positions. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications in pharmaceuticals and organic synthesis. It is a white to off-white crystalline solid, and its molecular structure contributes to its potential biological activity, including antimicrobial and antitumor properties. The presence of amino groups allows for hydrogen bonding and reactivity, making it a versatile intermediate in the synthesis of more complex molecules. As with many amines, it may exhibit basic properties, reacting with acids to form salts. Safety data should be consulted for handling, as it may pose health risks if inhaled or ingested. Overall, 2,6-Pyrazinediamine, hydrochloride is a valuable compound in chemical research and development, particularly in medicinal chemistry.

Formula: C₄H₆N₄·ClH

InChI: InChI=1S/C4H6N4.ClH/c5-3-1-7-2-4(6)8-3;/h1-2H,(H4,5,6,8);1H

InChI key: InChIKey=YMMNCVMWOKVYDG-UHFFFAOYSA-N

SMILES: NC1=NC(N)=CN=C1.Cl

Synonyms:

• 2,6-Pyrazinediamine, hydrochloride (1:1)

Pyrazine-2,6-diamine, HCl

CAS: 1370411-48-5

Formula: C₄H₇ClN₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 146.5782

Ref: IN-DA0012QM

Pyrazine-2,6-diamine hydrochloride

CAS: 1370411-48-5

Pyrazine-2,6-diamine hydrochloride

Purity: 95%

Molecular weight: 146.58g/mol

Ref: 54-OR79532

Pyrazine-2,6-diamine hydrochloride

CAS: 1370411-48-5

Formula: C₄H₇ClN₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 146.58

Ref: 10-F079286