CAS 137044-67-8
:2-(Trimethylsilyl)-3-furancarboxaldehyde
Description:
2-(Trimethylsilyl)-3-furancarboxaldehyde is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing one oxygen atom. The presence of a trimethylsilyl group enhances its stability and solubility in organic solvents, making it useful in various synthetic applications. This compound features an aldehyde functional group, which is reactive and can participate in various chemical reactions, including nucleophilic additions and condensation reactions. Its molecular structure allows for potential applications in organic synthesis, particularly in the preparation of more complex molecules. Additionally, the trimethylsilyl group can serve as a protecting group for alcohols and amines during chemical transformations. The compound is typically handled under standard laboratory conditions, and safety precautions should be taken due to the reactivity of the aldehyde group. Overall, 2-(Trimethylsilyl)-3-furancarboxaldehyde is a versatile intermediate in organic chemistry, particularly in the synthesis of pharmaceuticals and fine chemicals.
Formula:C8H12O2Si
InChI:InChI=1S/C8H12O2Si/c1-11(2,3)8-7(6-9)4-5-10-8/h4-6H,1-3H3
InChI key:InChIKey=NKFNZCRGYCVZOB-UHFFFAOYSA-N
SMILES:[Si](C)(C)(C)C1=C(C=O)C=CO1
Synonyms:- 2-(Trimethylsilyl)furan-3-carbaldehyde
- 3-Furancarboxaldehyde, 2-(trimethylsilyl)-
- 2-(Trimethylsilyl)-3-furancarboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
