CAS 137049-03-7

1-Propyl-1H-imidazole-4-sulfonyl chloride

Description:

1-Propyl-1H-imidazole-4-sulfonyl chloride is a chemical compound characterized by its sulfonyl chloride functional group attached to a propyl-substituted imidazole ring. This compound typically appears as a solid or liquid, depending on its purity and environmental conditions. It is known for its reactivity, particularly due to the presence of the sulfonyl chloride group, which can undergo nucleophilic substitution reactions, making it useful in organic synthesis and as a reagent in various chemical reactions. The imidazole ring contributes to its potential biological activity, as imidazole derivatives are often found in pharmaceuticals and agrochemicals. Additionally, this compound may exhibit properties such as solubility in polar solvents and stability under specific conditions, although it can be sensitive to moisture and should be handled with care. Safety precautions are essential when working with sulfonyl chlorides, as they can release toxic gases upon reaction with water or amines. Overall, 1-Propyl-1H-imidazole-4-sulfonyl chloride is a versatile compound with applications in synthetic chemistry and potential implications in medicinal chemistry.

Formula: C₆H₉ClN₂O₂S

InChI: InChI=1S/C6H9ClN2O2S/c1-2-3-9-4-6(8-5-9)12(7,10)11/h4-5H,2-3H2,1H3

InChI key: InChIKey=YXGLZNDBYAQTNN-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C1=CN(CCC)C=N1

Synonyms:

• 1H-Imidazole-4-sulfonyl chloride, 1-propyl-
• 1-Propyl-1H-imidazole-4-sulfonyl chloride

1-Propyl-1H-imidazole-4-sulfonyl chloride

CAS: 137049-03-7

Versatile small molecule scaffold

Formula: C₆H₉ClN₂O₂S

Purity: Min. 95%

Molecular weight: 208.67 g/mol

Ref: 3D-MFA04903