CAS 1370587-23-7

1H-Imidazo[4,5-b]pyridine, 1-(4-piperidinyl)-, hydrochloride (1:1)

Description:

1H-Imidazo[4,5-b]pyridine, 1-(4-piperidinyl)-, hydrochloride (1:1) is a chemical compound characterized by its imidazo-pyridine core structure, which is fused with a piperidine moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the hydrochloride salt form. The imidazo[4,5-b]pyridine framework is known for its biological activity, often serving as a scaffold in medicinal chemistry for developing pharmaceuticals, particularly in the fields of neuroscience and oncology. The piperidine group contributes to its pharmacological properties, enhancing interactions with biological targets. The hydrochloride salt form improves the compound's stability and solubility, making it suitable for various applications in drug formulation. As with many nitrogen-containing heterocycles, it may exhibit a range of biological activities, including potential effects on neurotransmitter systems. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and reactivity.

Formula: C₁₁H₁₄N₄·ClH

InChI: InChI=1S/C11H14N4.ClH/c1-2-10-11(13-5-1)14-8-15(10)9-3-6-12-7-4-9;/h1-2,5,8-9,12H,3-4,6-7H2;1H

InChI key: InChIKey=FZSFTGNVKPYFHT-UHFFFAOYSA-N

SMILES: N1(C=2C(N=C1)=NC=CC2)C3CCNCC3.Cl

Synonyms:

• 1H-Imidazo[4,5-b]pyridine, 1-(4-piperidinyl)-, hydrochloride (1:1)

4-{1H-Imidazo[4,5-b]pyridin-1-yl}piperidine hydrochloride

CAS: 1370587-23-7

4-{1H-Imidazo[4,5-b]pyridin-1-yl}piperidine hydrochloride

Purity: 97%

Molecular weight: 238.72g/mol

Ref: 54-OR33599