CymitQuimica logo

CAS 137076-50-7

:

1,4,7,10-Tetrakis(ethoxycarbonylmethyl)-1,4,7,10-tetraazacyclododecane

Description:
1,4,7,10-Tetrakis(ethoxycarbonylmethyl)-1,4,7,10-tetraazacyclododecane, with CAS number 137076-50-7, is a complex organic compound characterized by its tetraazacyclododecane backbone, which consists of a 12-membered ring containing four nitrogen atoms. This structure contributes to its chelating properties, allowing it to form stable complexes with metal ions. The presence of four ethoxycarbonylmethyl groups enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. The compound is likely to exhibit properties typical of polyamine derivatives, such as potential applications in coordination chemistry, catalysis, or as a ligand in metal ion binding. Its functional groups may also impart specific characteristics, such as increased lipophilicity or the ability to participate in hydrogen bonding. Overall, this compound's unique structure and functionalization make it a subject of interest in various fields, including medicinal chemistry and materials science.
Formula:C24H44N4O8
InChI:InChI=1/C24H44N4O8/c1-5-33-21(29)17-25-9-11-26(18-22(30)34-6-2)13-15-28(20-24(32)36-8-4)16-14-27(12-10-25)19-23(31)35-7-3/h5-20H2,1-4H3
SMILES:CCOC(=O)CN1CCN(CCN(CCN(CC1)CC(=O)OCC)CC(=O)OCC)CC(=O)OCC
Synonyms:
  • Tetraethyl 2,2',2'',2'''-(1,4,7,10-Tetraazacyclododecane-1,4,7,10-Tetrayl)Tetraacetate
  • DOTAEt
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.