CymitQuimica logo

CAS 137081-42-6

:

2-Chloro-2-fluorocyclopropanecarboxylic acid

Description:
2-Chloro-2-fluorocyclopropanecarboxylic acid is a chemical compound characterized by its unique cyclopropane structure, which features both a chlorine and a fluorine atom attached to the same carbon atom adjacent to a carboxylic acid functional group. This compound is typically a colorless to pale yellow liquid or solid, depending on its state at room temperature. It exhibits properties typical of carboxylic acids, such as acidity and the ability to form hydrogen bonds, which can influence its solubility in polar solvents. The presence of halogens (chlorine and fluorine) can significantly affect its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and additions. Additionally, the compound may have applications in pharmaceuticals or agrochemicals due to its structural characteristics. Safety data should be consulted, as halogenated compounds can pose health risks, including toxicity and environmental concerns. Overall, 2-Chloro-2-fluorocyclopropanecarboxylic acid is a compound of interest in organic chemistry and related fields.
Formula:C4H4ClFO2
InChI:InChI=1S/C4H4ClFO2/c5-4(6)1-2(4)3(7)8/h2H,1H2,(H,7,8)
InChI key:InChIKey=FOAOSDYEDASXTN-UHFFFAOYSA-N
SMILES:C(O)(=O)C1C(Cl)(F)C1
Synonyms:
  • 2-Chloro-2-fluorocyclopropanecarboxylic acid
  • 2-Chloro-2-fluorocyclopropane-1-carboxylic acid
  • Cyclopropanecarboxylic acid, 2-chloro-2-fluoro-
Found 3 products.