CAS 137089-36-2
:2-(2-decenoylamino)ethyl-2-(cyclohexylethyl)sulfide
Description:
2-(2-decenoylamino)ethyl-2-(cyclohexylethyl)sulfide, identified by its CAS number 137089-36-2, is a chemical compound characterized by its unique structural features, including a sulfide functional group and a decenoylamino moiety. This compound typically exhibits properties associated with both amines and sulfides, which may influence its solubility, reactivity, and potential applications. The presence of the decenoyl group suggests that it may participate in various chemical reactions, including acylation and nucleophilic substitutions. Additionally, the cyclohexylethyl group can impart hydrophobic characteristics, affecting the compound's interaction with biological membranes and its overall bioavailability. Such compounds may find applications in fields like medicinal chemistry, materials science, or as intermediates in organic synthesis. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Safety and handling considerations are also essential, as compounds containing sulfur and amine functionalities can exhibit toxicity or reactivity under certain conditions.
Formula:C20H37NOS
InChI:InChI=1/C20H37NOS/c1-2-3-4-5-6-7-11-14-20(22)21-16-18-23-17-15-19-12-9-8-10-13-19/h11,14,19H,2-10,12-13,15-18H2,1H3,(H,21,22)/b14-11+
Synonyms:- 2-Deces
- 2-Decenamide, N-(2-((2-cyclohexylethyl)thio)ethyl)-, (E)-
- (2E)-N-{2-[(2-cyclohexylethyl)sulfanyl]ethyl}dec-2-enamide
- 2-(2-Decenoylamino)ethyl-2-(cyclohexylethyl)sulfide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Deces
CAS:<p>2-Deces is a peptide that has been used as a research tool to study the interactions of ion channels and receptors. It is an inhibitor of the L-type calcium channel and it is able to block protein interactions by binding to the receptor. 2-Deces has been shown to inhibit the activity of nicotinic acetylcholine receptors, which are found in both muscles and neurons. The inhibition of these receptors leads to a decrease in muscle contractions, making 2-Deces an effective treatment for muscle spasms.<br>2-Deces has also been shown to inhibit potassium channels, which can lead to decreased neuronal excitability.</p>Formula:C20H37NOSPurity:Min. 95%Molecular weight:339.6 g/mol2-(E-2-decenoylamino)ethyl 2-(cyclohexylethyl) sulfide
CAS:2-Decenoylaminoethyl cyclohexylethyl sulfide prevents stress ulcers, stabilizes phospholipase A2 and prostaglandin E2.Formula:C20H37NOSPurity:98%Color and Shape:SolidMolecular weight:339.58

