CAS 137109-48-9
:atramycin A
Description:
Atramycin A is a natural product belonging to the class of compounds known as anthracyclines, which are primarily recognized for their use in cancer therapy. It is produced by certain strains of Streptomyces bacteria and exhibits notable antibacterial and antitumor properties. The chemical structure of atramycin A features a complex polycyclic framework, which is characteristic of anthracyclines, contributing to its biological activity. This compound interacts with DNA, inhibiting topoisomerase II, which is crucial for DNA replication and transcription, leading to cell cycle arrest and apoptosis in cancer cells. Atramycin A has garnered interest for its potential therapeutic applications, particularly in the treatment of various malignancies. Additionally, its unique structural features and mechanism of action make it a subject of ongoing research in medicinal chemistry, aiming to enhance its efficacy and reduce side effects. As with many natural products, the extraction and synthesis of atramycin A present challenges, but advancements in synthetic methodologies continue to facilitate its study and potential clinical use.
Formula:C25H24O9
InChI:InChI=1/C25H24O9/c1-9-6-11-8-14(27)18-19(16(11)13(26)7-9)21(29)12-4-3-5-15(17(12)22(18)30)34-25-24(32)23(31)20(28)10(2)33-25/h3-5,8-10,20,23-25,27-28,31-32H,6-7H2,1-2H3/t9-,10-,20-,23+,24+,25-/m0/s1
Synonyms:- Benz(a)anthracene-1,7,12(2H)-trione, 8-((6-deoxy-alpha-L-mannopyranosyl)oxy)-3,4-dihydro-6-hydroxy-3-methyl-, (S)-
- (3S)-6-hydroxy-3-methyl-1,7,12-trioxo-1,2,3,4,7,12-hexahydrotetraphen-8-yl 6-deoxy-alpha-L-mannopyranoside
- Atramycin A
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Atramycin A
CAS:Atramycin A is an antibiotic, which is derived from the Streptomyces genus, a prolific source of bioactive compounds. Streptomyces species are renowned for their ability to produce a vast array of secondary metabolites with diverse pharmacological activities. Atramycin A operates primarily through the inhibition of bacterial protein synthesis. It achieves this by binding to bacterial ribosomal subunits, thus interfering with peptide chain elongation and effectively halting bacterial growth.Formula:C25H24O9Purity:Min. 95%Molecular weight:468.50 g/molAtramycin A
CAS:Atramycin A is an anthraquinone antibiotic with antitumor properties.Formula:C25H24O9Color and Shape:SolidMolecular weight:468.453



