CAS 137109-49-0
:atramycin B
Description:
Atramycin B is a natural product belonging to the class of antibiotics known as aminoglycosides. It is derived from the fermentation of certain strains of Streptomyces bacteria. This compound exhibits a complex molecular structure characterized by multiple functional groups, which contribute to its biological activity. Atramycin B is known for its potent antimicrobial properties, particularly against a range of Gram-positive and some Gram-negative bacteria. Its mechanism of action typically involves inhibiting protein synthesis by binding to the bacterial ribosome, thereby disrupting the translation process. Additionally, atramycin B has shown potential in antitumor activity, making it a subject of interest in cancer research. The compound's stability, solubility, and bioavailability are important factors that influence its efficacy and therapeutic applications. As with many antibiotics, the development of resistance is a concern, necessitating ongoing research to optimize its use and explore its derivatives for enhanced activity. Overall, atramycin B represents a significant compound in the field of medicinal chemistry and antibiotic development.
Formula:C25H24O8
InChI:InChI=1/C25H24O8/c1-10-8-12-6-7-14-19(17(12)15(26)9-10)22(29)13-4-3-5-16(18(13)21(14)28)33-25-24(31)23(30)20(27)11(2)32-25/h3-7,10-11,20,23-25,27,30-31H,8-9H2,1-2H3/t10-,11-,20-,23+,24+,25-/m0/s1
Synonyms:- Benz(a)anthracene-1,7,12(2H)-trione, 8-((6-deoxy-alpha-L-mannopyranosyl)oxy)-3,4-dihydro-3-methyl-, (S)-
- (3S)-3-methyl-1,7,12-trioxo-1,2,3,4,7,12-hexahydrotetraphen-8-yl 6-deoxy-alpha-L-mannopyranoside
- Atramycin B
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Atramycin B
CAS:<p>Atramycin B is an antibiotic compound, which is produced by the actinomycete bacterium belonging to the genus Streptomyces. This compound functions as a potent inhibitor of bacterial protein synthesis by binding to the bacterial ribosome. Specifically, Atramycin B interferes with the translation process, thereby hindering the growth and proliferation of bacteria.</p>Formula:C25H24O8Purity:Min. 95%Molecular weight:452.50 g/mol



