CAS 137118-00-4

2-[2-(2-aminothiazol-4-yl)ethyl]isoindoline-1,3-dione hydrochloride

Description:

2-[2-(2-Aminothiazol-4-yl)ethyl]isoindoline-1,3-dione hydrochloride, with the CAS number 137118-00-4, is a chemical compound that features a complex structure combining an isoindoline-1,3-dione moiety with a thiazole derivative. This compound typically appears as a hydrochloride salt, which enhances its solubility in water, making it suitable for various biological applications. The presence of the thiazole ring contributes to its potential biological activity, often associated with antimicrobial or anticancer properties. The amino group in the thiazole structure may facilitate interactions with biological targets, while the isoindoline core can influence its pharmacokinetic properties. As a hydrochloride salt, it is likely to be more stable and easier to handle in laboratory settings. Overall, this compound's unique structural features suggest it may have significant utility in medicinal chemistry and drug development, although specific biological activities and mechanisms would require further investigation through empirical studies.

Formula: C₁₃H₁₂ClN₃O₂S

InChI: InChI=1/C13H11N3O2S.ClH/c14-13-15-8(7-19-13)5-6-16-11(17)9-3-1-2-4-10(9)12(16)18;/h1-4,7H,5-6H2,(H2,14,15);1H

SMILES: c1ccc2c(c1)C(=O)N(CCc1csc(=N)[nH]1)C2=O.Cl

N-[2-(2-Amino-1,3-thiazol-4-yl)ethyl]phthalimide hydrochloride

CAS: 137118-00-4

N-[2-(2-Amino-1,3-thiazol-4-yl)ethyl]phthalimide hydrochloride

Purity: ≥95%

Molecular weight: 309.77g/mol

Ref: 54-OR40627